Compound Q&A

What are the physical and chemical properties of 5,10,15,20-Tetrakis(4-methylphenyl)porphyrin (CAS: 14527-51-6)?

Answer

5,10,15,20-Tetrakis(4-methylphenyl)porphyrin
5,10,15,20-Tetrakis(4-methylphenyl)porphyrin (CAS: 14527-51-6) is a solid with a crystalline form. It has a high molecular weight and poor solubility in common organic solvents. This compound shows moderate reactivity towards electrophiles and can undergo substitution reactions. It has potential applications in photodynamic therapy and sensing due to its unique optical properties.

About

CAS No 14527-51-6
English Name 5,10,15,20-Tetrakis(4-methylphenyl)porphyrin
Molecular Formula C48H38N4
Molecular Weight 670.86 g/mol
SMILES CC1=CC=C(C=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C(N5)C(=C6C=CC2=N6)C7=CC=C(C=C7)C)C8=CC=C(C=C8)C)C=C4)C9=CC=C(C=C9)C)N3
InChIKey SFQNUQLWBBZIOZ-PJEPRTEXSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is 5,10,15,20-Tetrakis(4-methylphenyl)porphyrin (CAS: 14527-51-6) typically synthesized?

5,10,15,20-Tetrakis(4-methylphenyl)porphyrin (CAS: 14527-51-6) is synthesized through a complex mult...

Compound Q&A

What industries use 5,10,15,20-Tetrakis(4-methylphenyl)porphyrin (CAS: 14527-51-6)?

5,10,15,20-Tetrakis(4-methylphenyl)porphyrin (CAS: 14527-51-6) finds applications in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling 5,10,15,20-Tetrakis(4-methylphenyl)porphyrin (CAS: 14527-51-6)?

When handling 5,10,15,20-Tetrakis(4-methylphenyl)porphyrin (CAS: 14527-51-6), it is essential to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...