Compound Q&A

What precautions should be taken when handling 7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid (CAS: 97653-94-6)?

Answer

7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid
When handling 7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid, it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be handled in a well-ventilated area or a fume hood. Spills should be handled with appropriate absorbent materials and disposed of according to local regulations. Always consult the Safety Data Sheet (SDS) for detailed handling instructions and emergency procedures.

About

CAS No 97653-94-6
English Name 7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid
Molecular Formula C30H42O8
Molecular Weight 530.66 g/mol
SMILES CC(CC(=O)CC(C)C(=O)O)C1CC(=O)C2(C1(C(C(=O)C3=C2C(CC4C3(CCC(=O)C4(C)C)C)O)O)C)C
InChIKey LCIUOVOXWPIXOR-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid (CAS: 97653-94-6)?

7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid is a white crystalline solid with a molecu...

Compound Q&A

How is 7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid (CAS: 97653-94-6) typically synthesized?

7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid can be synthesized through a multi-step pr...

Compound Q&A

What industries use 7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid (CAS: 97653-94-6)?

7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid is primarily used in the pharmaceutical in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...