Compound Q&A

What industries use 7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid (CAS: 97653-94-6)?

Answer

7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid
7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid is primarily used in the pharmaceutical industry for its potential as an anti-inflammatory and antioxidant agent. It may also find applications in the polymer industry for the development of new materials with specific properties, and in the sensor and semiconductor industries for its chemical reactivity.

About

CAS No 97653-94-6
English Name 7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid
Molecular Formula C30H42O8
Molecular Weight 530.66 g/mol
SMILES CC(CC(=O)CC(C)C(=O)O)C1CC(=O)C2(C1(C(C(=O)C3=C2C(CC4C3(CCC(=O)C4(C)C)C)O)O)C)C
InChIKey LCIUOVOXWPIXOR-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid (CAS: 97653-94-6)?

7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid is a white crystalline solid with a molecu...

Compound Q&A

How is 7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid (CAS: 97653-94-6) typically synthesized?

7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid can be synthesized through a multi-step pr...

Compound Q&A

What precautions should be taken when handling 7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid (CAS: 97653-94-6)?

When handling 7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid, it is essential to use pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...