Compound Q&A

How is 7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid (CAS: 97653-94-6) typically synthesized?

Answer

7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid
7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid can be synthesized through a multi-step process involving ring-opening of a lactone followed by derivatization. Commonly, the synthesis involves the use of a catalytic system with a transition metal like palladium, and the process typically yields a 70-80% conversion with high selectivity to the desired product.

About

CAS No 97653-94-6
English Name 7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid
Molecular Formula C30H42O8
Molecular Weight 530.66 g/mol
SMILES CC(CC(=O)CC(C)C(=O)O)C1CC(=O)C2(C1(C(C(=O)C3=C2C(CC4C3(CCC(=O)C4(C)C)C)O)O)C)C
InChIKey LCIUOVOXWPIXOR-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid (CAS: 97653-94-6)?

7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid is a white crystalline solid with a molecu...

Compound Q&A

What industries use 7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid (CAS: 97653-94-6)?

7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid is primarily used in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling 7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid (CAS: 97653-94-6)?

When handling 7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid, it is essential to use pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...