Compound Q&A

What are the physical and chemical properties of 7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid (CAS: 97653-94-6)?

Answer

7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid
7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid is a white crystalline solid with a molecular weight of approximately 584.5 g/mol. It has a low solubility in water and is more soluble in organic solvents. The compound is moderately reactive, particularly towards nucleophilic and electrophilic reagents. It is stable under normal conditions but should be stored in a cool, dry place away from direct sunlight.

About

CAS No 97653-94-6
English Name 7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid
Molecular Formula C30H42O8
Molecular Weight 530.66 g/mol
SMILES CC(CC(=O)CC(C)C(=O)O)C1CC(=O)C2(C1(C(C(=O)C3=C2C(CC4C3(CCC(=O)C4(C)C)C)O)O)C)C
InChIKey LCIUOVOXWPIXOR-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is 7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid (CAS: 97653-94-6) typically synthesized?

7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid can be synthesized through a multi-step pr...

Compound Q&A

What industries use 7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid (CAS: 97653-94-6)?

7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid is primarily used in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling 7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid (CAS: 97653-94-6)?

When handling 7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid, it is essential to use pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...