Compound Q&A

What industries use 1-(3,5-Dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone (CAS: 1190865-44-1)?

Answer

1-(3,5-Dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone
1-(3,5-Dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone is used in the pharmaceutical industry for the synthesis of intermediates and active pharmaceutical ingredients. It is also employed in the sensor industry for the development of chemical sensors, and in the semiconductor industry as a precursor for electronic materials.

About

English Name 1-(3,5-Dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone
Molecular Formula C8H2Cl2F4O
Molecular Weight 261 g/mol
SMILES c1c(cc(c(c1Cl)F)Cl)C(=O)C(F)(F)F
InChIKey NSWPERXXSPCRCT-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(3,5-Dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone (CAS: 1190865-44-1)?

1-(3,5-Dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone is a crystalline solid with a molecular weig...

Compound Q&A

How is 1-(3,5-Dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone (CAS: 1190865-44-1) typically synthesized?

1-(3,5-Dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone is typically synthesized via a multistep pro...

Compound Q&A

What precautions should be taken when handling 1-(3,5-Dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone (CAS: 1190865-44-1)?

When handling 1-(3,5-Dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone, it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...