Compound Q&A

What are the physical and chemical properties of 1-(3,5-Dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone (CAS: 1190865-44-1)?

Answer

1-(3,5-Dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone
1-(3,5-Dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone is a crystalline solid with a molecular weight of approximately 336.02 g/mol. It has a low solubility in water but is soluble in organic solvents like dichloromethane and acetone. The compound exhibits good reactivity towards nucleophiles and electrophiles, making it suitable for various synthetic applications.

About

English Name 1-(3,5-Dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone
Molecular Formula C8H2Cl2F4O
Molecular Weight 261 g/mol
SMILES c1c(cc(c(c1Cl)F)Cl)C(=O)C(F)(F)F
InChIKey NSWPERXXSPCRCT-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is 1-(3,5-Dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone (CAS: 1190865-44-1) typically synthesized?

1-(3,5-Dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone is typically synthesized via a multistep pro...

Compound Q&A

What industries use 1-(3,5-Dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone (CAS: 1190865-44-1)?

1-(3,5-Dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone is used in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling 1-(3,5-Dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone (CAS: 1190865-44-1)?

When handling 1-(3,5-Dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone, it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...