Compound Q&A

How is 1-(3,5-Dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone (CAS: 1190865-44-1) typically synthesized?

Answer

1-(3,5-Dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone
1-(3,5-Dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone is typically synthesized via a multistep process involving the protection of an alcohol functionality, followed by a fluorination reaction, and subsequent coupling reactions. The use of a palladium catalyst can enhance the selectivity and yield of the product.

About

English Name 1-(3,5-Dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone
Molecular Formula C8H2Cl2F4O
Molecular Weight 261 g/mol
SMILES c1c(cc(c(c1Cl)F)Cl)C(=O)C(F)(F)F
InChIKey NSWPERXXSPCRCT-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(3,5-Dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone (CAS: 1190865-44-1)?

1-(3,5-Dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone is a crystalline solid with a molecular weig...

Compound Q&A

What industries use 1-(3,5-Dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone (CAS: 1190865-44-1)?

1-(3,5-Dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone is used in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling 1-(3,5-Dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone (CAS: 1190865-44-1)?

When handling 1-(3,5-Dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone, it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...