Compound Q&A

What precautions should be taken when handling 2-Amino-3-(trifluoromethoxy)benzoic acid (CAS: 561304-41-4)?

Answer

2-Amino-3-(trifluoromethoxy)benzoic acid
When handling 2-Amino-3-(trifluoromethoxy)benzoic acid (CAS: 561304-41-4), safety precautions include wearing appropriate personal protective equipment (PPE) such as gloves and goggles. Work in a fume hood to minimize exposure to vapors. Spills should be cleaned up with absorbent materials and disposed of according to local regulations. Always consult the Safety Data Sheet (SDS) for detailed handling and safety information.

About

English Name 2-Amino-3-(trifluoromethoxy)benzoic acid
Molecular Formula C8H6F3NO3
Molecular Weight 221.13 g/mol
SMILES C1=CC(=C(C(=C1)OC(F)(F)F)N)C(=O)O
InChIKey BQPQFVVEWXYRMH-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Amino-3-(trifluoromethoxy)benzoic acid (CAS: 561304-41-4)?

2-Amino-3-(trifluoromethoxy)benzoic acid (CAS: 561304-41-4) is a crystalline compound with a molecul...

Compound Q&A

How is 2-Amino-3-(trifluoromethoxy)benzoic acid (CAS: 561304-41-4) typically synthesized?

2-Amino-3-(trifluoromethoxy)benzoic acid is typically synthesized via the Friedel-Crafts amination o...

Compound Q&A

What industries use 2-Amino-3-(trifluoromethoxy)benzoic acid (CAS: 561304-41-4)?

2-Amino-3-(trifluoromethoxy)benzoic acid finds applications in the pharmaceutical industry, particul...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...