Compound Q&A

What are the physical and chemical properties of 2-Amino-3-(trifluoromethoxy)benzoic acid (CAS: 561304-41-4)?

Answer

2-Amino-3-(trifluoromethoxy)benzoic acid
2-Amino-3-(trifluoromethoxy)benzoic acid (CAS: 561304-41-4) is a crystalline compound with a molecular weight of approximately 264.12 g/mol. It has a high solubility in water (10 g/L at 20°C) and poor solubility in common organic solvents. It is moderately reactive, forming stable complexes with metal ions and showing some basic and acidic properties.

About

English Name 2-Amino-3-(trifluoromethoxy)benzoic acid
Molecular Formula C8H6F3NO3
Molecular Weight 221.13 g/mol
SMILES C1=CC(=C(C(=C1)OC(F)(F)F)N)C(=O)O
InChIKey BQPQFVVEWXYRMH-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is 2-Amino-3-(trifluoromethoxy)benzoic acid (CAS: 561304-41-4) typically synthesized?

2-Amino-3-(trifluoromethoxy)benzoic acid is typically synthesized via the Friedel-Crafts amination o...

Compound Q&A

What industries use 2-Amino-3-(trifluoromethoxy)benzoic acid (CAS: 561304-41-4)?

2-Amino-3-(trifluoromethoxy)benzoic acid finds applications in the pharmaceutical industry, particul...

Compound Q&A

What precautions should be taken when handling 2-Amino-3-(trifluoromethoxy)benzoic acid (CAS: 561304-41-4)?

When handling 2-Amino-3-(trifluoromethoxy)benzoic acid (CAS: 561304-41-4), safety precautions includ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...