Compound Q&A

What industries use 2-Amino-3-(trifluoromethoxy)benzoic acid (CAS: 561304-41-4)?

Answer

2-Amino-3-(trifluoromethoxy)benzoic acid
2-Amino-3-(trifluoromethoxy)benzoic acid finds applications in the pharmaceutical industry, particularly in the synthesis of various drug compounds. It is also used in the development of sensors and semiconductors due to its unique electronic properties. Additionally, it has potential uses in the polymer industry for specific functional polymer modification.

About

English Name 2-Amino-3-(trifluoromethoxy)benzoic acid
Molecular Formula C8H6F3NO3
Molecular Weight 221.13 g/mol
SMILES C1=CC(=C(C(=C1)OC(F)(F)F)N)C(=O)O
InChIKey BQPQFVVEWXYRMH-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Amino-3-(trifluoromethoxy)benzoic acid (CAS: 561304-41-4)?

2-Amino-3-(trifluoromethoxy)benzoic acid (CAS: 561304-41-4) is a crystalline compound with a molecul...

Compound Q&A

How is 2-Amino-3-(trifluoromethoxy)benzoic acid (CAS: 561304-41-4) typically synthesized?

2-Amino-3-(trifluoromethoxy)benzoic acid is typically synthesized via the Friedel-Crafts amination o...

Compound Q&A

What precautions should be taken when handling 2-Amino-3-(trifluoromethoxy)benzoic acid (CAS: 561304-41-4)?

When handling 2-Amino-3-(trifluoromethoxy)benzoic acid (CAS: 561304-41-4), safety precautions includ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...