Compound Q&A

What precautions should be taken when handling 4,5-Dichloro-2-thiophenesulfonamide (CAS: 256353-34-1)?

Answer

4,5-Dichloro-2-thiophenesulfonamide
When handling 4,5-Dichloro-2-thiophenesulfonamide (CAS: 256353-34-1), it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or with a fume hood to minimize inhalation risk. Spills should be cleaned up using appropriate absorbents, and the material safety data sheet (MSDS) should be consulted for detailed emergency procedures and disposal methods.

About

English Name 4,5-Dichloro-2-thiophenesulfonamide
Molecular Formula C4H3Cl2NO2S2
Molecular Weight 232.11 g/mol
SMILES C1=C(SC(=C1Cl)Cl)S(=O)(=O)N
InChIKey JKBNSTFOQDGQLS-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,5-Dichloro-2-thiophenesulfonamide (CAS: 256353-34-1)?

4,5-Dichloro-2-thiophenesulfonamide (CAS: 256353-34-1) is a crystalline solid with a molecular weigh...

Compound Q&A

How is 4,5-Dichloro-2-thiophenesulfonamide (CAS: 256353-34-1) typically synthesized?

4,5-Dichloro-2-thiophenesulfonamide (CAS: 256353-34-1) is commonly synthesized via the sulfonation o...

Compound Q&A

What industries use 4,5-Dichloro-2-thiophenesulfonamide (CAS: 256353-34-1)?

4,5-Dichloro-2-thiophenesulfonamide (CAS: 256353-34-1) is primarily used in the pharmaceutical indus...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...