Compound Q&A

How is 4,5-Dichloro-2-thiophenesulfonamide (CAS: 256353-34-1) typically synthesized?

Answer

4,5-Dichloro-2-thiophenesulfonamide
4,5-Dichloro-2-thiophenesulfonamide (CAS: 256353-34-1) is commonly synthesized via the sulfonation of 2-chlorothiophene followed by chlorination. The process involves using sulfur trioxide or chlorosulfonic acid as the sulfonating agent and chlorine gas for chlorination. The reaction is typically carried out in the presence of a suitable catalyst to achieve high selectivity and yield.

About

English Name 4,5-Dichloro-2-thiophenesulfonamide
Molecular Formula C4H3Cl2NO2S2
Molecular Weight 232.11 g/mol
SMILES C1=C(SC(=C1Cl)Cl)S(=O)(=O)N
InChIKey JKBNSTFOQDGQLS-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,5-Dichloro-2-thiophenesulfonamide (CAS: 256353-34-1)?

4,5-Dichloro-2-thiophenesulfonamide (CAS: 256353-34-1) is a crystalline solid with a molecular weigh...

Compound Q&A

What industries use 4,5-Dichloro-2-thiophenesulfonamide (CAS: 256353-34-1)?

4,5-Dichloro-2-thiophenesulfonamide (CAS: 256353-34-1) is primarily used in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling 4,5-Dichloro-2-thiophenesulfonamide (CAS: 256353-34-1)?

When handling 4,5-Dichloro-2-thiophenesulfonamide (CAS: 256353-34-1), it is crucial to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...