Compound Q&A

What industries use 4,5-Dichloro-2-thiophenesulfonamide (CAS: 256353-34-1)?

Answer

4,5-Dichloro-2-thiophenesulfonamide
4,5-Dichloro-2-thiophenesulfonamide (CAS: 256353-34-1) is primarily used in the pharmaceutical industry for the synthesis of various organic compounds. It is also utilized in the polymer industry for modifying the properties of plastics and resins. Additionally, it can be used in the development of sensors and as a component in semiconductor manufacturing processes.

About

English Name 4,5-Dichloro-2-thiophenesulfonamide
Molecular Formula C4H3Cl2NO2S2
Molecular Weight 232.11 g/mol
SMILES C1=C(SC(=C1Cl)Cl)S(=O)(=O)N
InChIKey JKBNSTFOQDGQLS-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,5-Dichloro-2-thiophenesulfonamide (CAS: 256353-34-1)?

4,5-Dichloro-2-thiophenesulfonamide (CAS: 256353-34-1) is a crystalline solid with a molecular weigh...

Compound Q&A

How is 4,5-Dichloro-2-thiophenesulfonamide (CAS: 256353-34-1) typically synthesized?

4,5-Dichloro-2-thiophenesulfonamide (CAS: 256353-34-1) is commonly synthesized via the sulfonation o...

Compound Q&A

What precautions should be taken when handling 4,5-Dichloro-2-thiophenesulfonamide (CAS: 256353-34-1)?

When handling 4,5-Dichloro-2-thiophenesulfonamide (CAS: 256353-34-1), it is crucial to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...