Compound Q&A

What industries use (R)-2-Benzhydrylpyrrolidine hydrochloride (CAS: 23627-61-4)?

Answer

(R)-2-Benzhydrylpyrrolidine hydrochloride
(R)-2-Benzhydrylpyrrolidine hydrochloride is primarily used in the pharmaceutical industry for the synthesis of complex organic molecules and in the polymer industry for developing new materials with specific properties. It is also utilized in the production of sensors and semiconductors due to its unique chemical structure and reactivity.

About

CAS No 23627-61-4
English Name (R)-2-Benzhydrylpyrrolidine hydrochloride
Molecular Formula C17H20ClN
Molecular Weight 273.81 g/mol
SMILES C1CC(NC1)C(C2=CC=CC=C2)C3=CC=CC=C3.Cl
InChIKey KTGRJTGIWVDSKZ-PKLMIRHRSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of (R)-2-Benzhydrylpyrrolidine hydrochloride (CAS: 23627-61-4)?

(R)-2-Benzhydrylpyrrolidine hydrochloride is a white crystalline solid with a molecular weight of ap...

Compound Q&A

How is (R)-2-Benzhydrylpyrrolidine hydrochloride (CAS: 23627-61-4) typically synthesized?

(R)-2-Benzhydrylpyrrolidine hydrochloride is typically synthesized through a multi-step process invo...

Compound Q&A

What precautions should be taken when handling (R)-2-Benzhydrylpyrrolidine hydrochloride (CAS: 23627-61-4)?

When handling (R)-2-Benzhydrylpyrrolidine hydrochloride, it is essential to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...