Compound Q&A

How is (R)-2-Benzhydrylpyrrolidine hydrochloride (CAS: 23627-61-4) typically synthesized?

Answer

(R)-2-Benzhydrylpyrrolidine hydrochloride
(R)-2-Benzhydrylpyrrolidine hydrochloride is typically synthesized through a multi-step process involving the formation of a pyrrolidine ring and subsequent reaction with a benzhydryl bromide derivative. The synthesis often requires the use of a Lewis acid catalyst and is known for its high yield and good selectivity, making it suitable for industrial applications.

About

CAS No 23627-61-4
English Name (R)-2-Benzhydrylpyrrolidine hydrochloride
Molecular Formula C17H20ClN
Molecular Weight 273.81 g/mol
SMILES C1CC(NC1)C(C2=CC=CC=C2)C3=CC=CC=C3.Cl
InChIKey KTGRJTGIWVDSKZ-PKLMIRHRSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of (R)-2-Benzhydrylpyrrolidine hydrochloride (CAS: 23627-61-4)?

(R)-2-Benzhydrylpyrrolidine hydrochloride is a white crystalline solid with a molecular weight of ap...

Compound Q&A

What industries use (R)-2-Benzhydrylpyrrolidine hydrochloride (CAS: 23627-61-4)?

(R)-2-Benzhydrylpyrrolidine hydrochloride is primarily used in the pharmaceutical industry for the s...

Compound Q&A

What precautions should be taken when handling (R)-2-Benzhydrylpyrrolidine hydrochloride (CAS: 23627-61-4)?

When handling (R)-2-Benzhydrylpyrrolidine hydrochloride, it is essential to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...