Compound Q&A

What are the physical and chemical properties of (R)-2-Benzhydrylpyrrolidine hydrochloride (CAS: 23627-61-4)?

Answer

(R)-2-Benzhydrylpyrrolidine hydrochloride
(R)-2-Benzhydrylpyrrolidine hydrochloride is a white crystalline solid with a molecular weight of approximately 332.4 g/mol. It has a low solubility in water but is more soluble in organic solvents like methanol and ethanol. This compound is known for its moderate reactivity, particularly in nucleophilic substitution reactions. It is often used in pharmaceutical and chemical synthesis due to its stability and reactivity.

About

CAS No 23627-61-4
English Name (R)-2-Benzhydrylpyrrolidine hydrochloride
Molecular Formula C17H20ClN
Molecular Weight 273.81 g/mol
SMILES C1CC(NC1)C(C2=CC=CC=C2)C3=CC=CC=C3.Cl
InChIKey KTGRJTGIWVDSKZ-PKLMIRHRSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is (R)-2-Benzhydrylpyrrolidine hydrochloride (CAS: 23627-61-4) typically synthesized?

(R)-2-Benzhydrylpyrrolidine hydrochloride is typically synthesized through a multi-step process invo...

Compound Q&A

What industries use (R)-2-Benzhydrylpyrrolidine hydrochloride (CAS: 23627-61-4)?

(R)-2-Benzhydrylpyrrolidine hydrochloride is primarily used in the pharmaceutical industry for the s...

Compound Q&A

What precautions should be taken when handling (R)-2-Benzhydrylpyrrolidine hydrochloride (CAS: 23627-61-4)?

When handling (R)-2-Benzhydrylpyrrolidine hydrochloride, it is essential to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...