Compound Q&A

What precautions should be taken when handling 2,4,7-Trichloropyrido[2,3-d]pyrimidine (CAS: 938443-20-0)?

Answer

2,4,7-Trichloropyrido[2,3-d]pyrimidine
When handling 2,4,7-Trichloropyrido[2,3-d]pyrimidine, it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work must be conducted in a well-ventilated area or a fume hood. Spills should be handled with caution, using appropriate containment measures and materials. Always consult the Material Safety Data Sheet (MSDS/SDS) for detailed safety information and emergency procedures.

About

English Name 2,4,7-Trichloropyrido[2,3-d]pyrimidine
Molecular Formula C7H2Cl3N3
Molecular Weight 234.47 g/mol
SMILES C1=CC(=NC2=C1C(=NC(=N2)Cl)Cl)Cl
InChIKey DNFDLCRLLQVUQK-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4,7-Trichloropyrido[2,3-d]pyrimidine (CAS: 938443-20-0)?

2,4,7-Trichloropyrido[2,3-d]pyrimidine is a solid with a crystalline form. Its molecular weight is a...

Compound Q&A

How is 2,4,7-Trichloropyrido[2,3-d]pyrimidine (CAS: 938443-20-0) typically synthesized?

2,4,7-Trichloropyrido[2,3-d]pyrimidine is typically synthesized through the condensation of 2,4,7-tr...

Compound Q&A

What industries use 2,4,7-Trichloropyrido[2,3-d]pyrimidine (CAS: 938443-20-0)?

2,4,7-Trichloropyrido[2,3-d]pyrimidine finds applications in the pharmaceutical industry for the syn...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...