Compound Q&A

What industries use 2,4,7-Trichloropyrido[2,3-d]pyrimidine (CAS: 938443-20-0)?

Answer

2,4,7-Trichloropyrido[2,3-d]pyrimidine
2,4,7-Trichloropyrido[2,3-d]pyrimidine finds applications in the pharmaceutical industry for the synthesis of certain drugs. It is also used in the chemical industry for the production of dyes and pigments. Additionally, it has potential applications in the development of sensors and materials science.

About

English Name 2,4,7-Trichloropyrido[2,3-d]pyrimidine
Molecular Formula C7H2Cl3N3
Molecular Weight 234.47 g/mol
SMILES C1=CC(=NC2=C1C(=NC(=N2)Cl)Cl)Cl
InChIKey DNFDLCRLLQVUQK-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4,7-Trichloropyrido[2,3-d]pyrimidine (CAS: 938443-20-0)?

2,4,7-Trichloropyrido[2,3-d]pyrimidine is a solid with a crystalline form. Its molecular weight is a...

Compound Q&A

How is 2,4,7-Trichloropyrido[2,3-d]pyrimidine (CAS: 938443-20-0) typically synthesized?

2,4,7-Trichloropyrido[2,3-d]pyrimidine is typically synthesized through the condensation of 2,4,7-tr...

Compound Q&A

What precautions should be taken when handling 2,4,7-Trichloropyrido[2,3-d]pyrimidine (CAS: 938443-20-0)?

When handling 2,4,7-Trichloropyrido[2,3-d]pyrimidine, it is essential to use appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...