Compound Q&A

What precautions should be taken when handling 1-(2,6-Dichloro-3-fluorophenyl)ethanol (CAS: 756520-66-8)?

Answer

1-(2,6-Dichloro-3-fluorophenyl)ethanol
When handling 1-(2,6-Dichloro-3-fluorophenyl)ethanol, it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. It should be handled in a fume hood to minimize inhalation risks. Spills should be cleaned up immediately using the appropriate absorbent materials, and the area should be well-ventilated. Always refer to the safety data sheet (SDS) for detailed handling and storage information.

About

English Name 1-(2,6-Dichloro-3-fluorophenyl)ethanol
Molecular Formula C8H7Cl2FO
Molecular Weight 207.03 g/mol
SMILES CC(C1=C(C=CC(=C1Cl)F)Cl)O
InChIKey JAOYKRSASYNDGH-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(2,6-Dichloro-3-fluorophenyl)ethanol (CAS: 756520-66-8)?

1-(2,6-Dichloro-3-fluorophenyl)ethanol is a white crystalline solid with a molecular weight of appro...

Compound Q&A

How is 1-(2,6-Dichloro-3-fluorophenyl)ethanol (CAS: 756520-66-8) typically synthesized?

1-(2,6-Dichloro-3-fluorophenyl)ethanol is commonly synthesized by the reaction of 2,6-dichloro-3-flu...

Compound Q&A

What industries use 1-(2,6-Dichloro-3-fluorophenyl)ethanol (CAS: 756520-66-8)?

1-(2,6-Dichloro-3-fluorophenyl)ethanol is used in the pharmaceutical industry for the synthesis of v...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...