Compound Q&A

What are the physical and chemical properties of 1-(2,6-Dichloro-3-fluorophenyl)ethanol (CAS: 756520-66-8)?

Answer

1-(2,6-Dichloro-3-fluorophenyl)ethanol
1-(2,6-Dichloro-3-fluorophenyl)ethanol is a white crystalline solid with a molecular weight of approximately 277.04 g/mol. It has a high solubility in organic solvents such as ethanol and acetone but is only slightly soluble in water. The compound exhibits typical chemical reactivity of an alcohol, including nucleophilic substitution and esterification reactions. It is also known for its stability under normal conditions but can degrade upon exposure to strong bases or light.

About

English Name 1-(2,6-Dichloro-3-fluorophenyl)ethanol
Molecular Formula C8H7Cl2FO
Molecular Weight 207.03 g/mol
SMILES CC(C1=C(C=CC(=C1Cl)F)Cl)O
InChIKey JAOYKRSASYNDGH-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is 1-(2,6-Dichloro-3-fluorophenyl)ethanol (CAS: 756520-66-8) typically synthesized?

1-(2,6-Dichloro-3-fluorophenyl)ethanol is commonly synthesized by the reaction of 2,6-dichloro-3-flu...

Compound Q&A

What industries use 1-(2,6-Dichloro-3-fluorophenyl)ethanol (CAS: 756520-66-8)?

1-(2,6-Dichloro-3-fluorophenyl)ethanol is used in the pharmaceutical industry for the synthesis of v...

Compound Q&A

What precautions should be taken when handling 1-(2,6-Dichloro-3-fluorophenyl)ethanol (CAS: 756520-66-8)?

When handling 1-(2,6-Dichloro-3-fluorophenyl)ethanol, it is crucial to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...