Compound Q&A

How is 3-Fluoro-4-nitropyridine 1-oxide (CAS: 769-54-0) typically synthesized?

Answer

3-Fluoro-4-nitropyridine 1-oxide
3-Fluoro-4-nitropyridine 1-oxide can be synthesized by the nitration of 3-fluoropyridine followed by oxidation of the nitro group to the 1-oxide form. This process typically involves the use of nitric acid and sulfuric acid as reagents. The reaction is selective and yields a high percentage of the desired product.

About

CAS No 769-54-0
English Name 3-Fluoro-4-nitropyridine 1-oxide
Molecular Formula C5H3FN2O3
Molecular Weight 158.09 g/mol
SMILES C1=C[N+](=CC(=C1[N+](=O)[O-])F)[O-]
InChIKey QHWIGULJOZAPAQ-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Fluoro-4-nitropyridine 1-oxide (CAS: 769-54-0)?

3-Fluoro-4-nitropyridine 1-oxide is a crystalline solid with a molecular weight of approximately 222...

Compound Q&A

What industries use 3-Fluoro-4-nitropyridine 1-oxide (CAS: 769-54-0)?

3-Fluoro-4-nitropyridine 1-oxide is primarily used in the pharmaceutical and chemical industries for...

Compound Q&A

What precautions should be taken when handling 3-Fluoro-4-nitropyridine 1-oxide (CAS: 769-54-0)?

When handling 3-Fluoro-4-nitropyridine 1-oxide, it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...