Compound Q&A

What are the physical and chemical properties of 3-Fluoro-4-nitropyridine 1-oxide (CAS: 769-54-0)?

Answer

3-Fluoro-4-nitropyridine 1-oxide
3-Fluoro-4-nitropyridine 1-oxide is a crystalline solid with a molecular weight of approximately 222.04 g/mol. It is slightly soluble in water and more soluble in organic solvents. This compound is highly reactive towards reducing agents and can undergo substitution reactions. It is commonly used in the synthesis of various pyridine derivatives.

About

CAS No 769-54-0
English Name 3-Fluoro-4-nitropyridine 1-oxide
Molecular Formula C5H3FN2O3
Molecular Weight 158.09 g/mol
SMILES C1=C[N+](=CC(=C1[N+](=O)[O-])F)[O-]
InChIKey QHWIGULJOZAPAQ-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is 3-Fluoro-4-nitropyridine 1-oxide (CAS: 769-54-0) typically synthesized?

3-Fluoro-4-nitropyridine 1-oxide can be synthesized by the nitration of 3-fluoropyridine followed by...

Compound Q&A

What industries use 3-Fluoro-4-nitropyridine 1-oxide (CAS: 769-54-0)?

3-Fluoro-4-nitropyridine 1-oxide is primarily used in the pharmaceutical and chemical industries for...

Compound Q&A

What precautions should be taken when handling 3-Fluoro-4-nitropyridine 1-oxide (CAS: 769-54-0)?

When handling 3-Fluoro-4-nitropyridine 1-oxide, it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...