Compound Q&A

What precautions should be taken when handling 4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid (CAS: 8011-86-7)?

Answer

4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid
When handling 4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid, it is crucial to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. The compound should be stored in a cool, dry place, away from direct sunlight and heat sources. In case of a spill, it should be cleaned up using appropriate absorbents, and the area should be thoroughly rinsed. Always consult the safety data sheet (SDS) for specific handling and disposal instructions.

About

CAS No 8011-86-7
English Name 4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid
Molecular Formula C10H9NO7S2
Molecular Weight 319.32 g/mol
SMILES C1=CC(=CC=C1N=NC2=C(C(=CC(=C2O)N=NC3=C4C(=CC(=C3)S(=O)(=O)[O-])C=C(C=C4O)S(=O)(=O)[O-])N=NC5=C(C(=CC(=C5)[N+](=O)[O-])[N+](=O)[O-])O)O)[N+](=O)[O-].[Na+].[Na+]
InChIKey APRRQJCCBSJQOQ-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid (CAS: 8011-86-7)?

4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid is a crystalline solid with a molecular weight of a...

Compound Q&A

How is 4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid (CAS: 8011-86-7) typically synthesized?

4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid is usually synthesized through the sulfonation of 4...

Compound Q&A

What industries use 4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid (CAS: 8011-86-7)?

4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid is primarily used in the pharmaceutical industry fo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...