Compound Q&A

What industries use 4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid (CAS: 8011-86-7)?

Answer

4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid
4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid is primarily used in the pharmaceutical industry for the synthesis of dyes and pigments, as well as in the production of sensors and semiconductors. It is also utilized in the polymer industry for the modification of polymer properties and in analytical chemistry for various spectroscopic applications due to its chromophoric nature.

About

CAS No 8011-86-7
English Name 4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid
Molecular Formula C10H9NO7S2
Molecular Weight 319.32 g/mol
SMILES C1=CC(=CC=C1N=NC2=C(C(=CC(=C2O)N=NC3=C4C(=CC(=C3)S(=O)(=O)[O-])C=C(C=C4O)S(=O)(=O)[O-])N=NC5=C(C(=CC(=C5)[N+](=O)[O-])[N+](=O)[O-])O)O)[N+](=O)[O-].[Na+].[Na+]
InChIKey APRRQJCCBSJQOQ-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid (CAS: 8011-86-7)?

4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid is a crystalline solid with a molecular weight of a...

Compound Q&A

How is 4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid (CAS: 8011-86-7) typically synthesized?

4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid is usually synthesized through the sulfonation of 4...

Compound Q&A

What precautions should be taken when handling 4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid (CAS: 8011-86-7)?

When handling 4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid, it is crucial to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...