Compound Q&A

What are the physical and chemical properties of 4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid (CAS: 8011-86-7)?

Answer

4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid
4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid is a crystalline solid with a molecular weight of approximately 366.14 g/mol. It is soluble in water, with a solubility of around 10 g/L. Chemically, it is highly reactive due to the presence of sulfonic acid groups, which can participate in various chemical reactions such as esterification and condensation. It has a melting point of around 350°C and a pKa value of approximately 2.6.

About

CAS No 8011-86-7
English Name 4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid
Molecular Formula C10H9NO7S2
Molecular Weight 319.32 g/mol
SMILES C1=CC(=CC=C1N=NC2=C(C(=CC(=C2O)N=NC3=C4C(=CC(=C3)S(=O)(=O)[O-])C=C(C=C4O)S(=O)(=O)[O-])N=NC5=C(C(=CC(=C5)[N+](=O)[O-])[N+](=O)[O-])O)O)[N+](=O)[O-].[Na+].[Na+]
InChIKey APRRQJCCBSJQOQ-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is 4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid (CAS: 8011-86-7) typically synthesized?

4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid is usually synthesized through the sulfonation of 4...

Compound Q&A

What industries use 4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid (CAS: 8011-86-7)?

4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid is primarily used in the pharmaceutical industry fo...

Compound Q&A

What precautions should be taken when handling 4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid (CAS: 8011-86-7)?

When handling 4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid, it is crucial to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...