Compound Q&A

What precautions should be taken when handling 7-Chloroquinoline-3-carboxylic acid (CAS: 892874-49-6)?

Answer

7-Chloroquinoline-3-carboxylic acid
When handling 7-Chloroquinoline-3-carboxylic acid, appropriate personal protective equipment (PPE) should be worn, including gloves, safety goggles, and a lab coat. The compound should be used in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be handled carefully, and the area should be ventilated until the spill is cleaned up. It is recommended to follow the safety data sheet (SDS) for detailed handling instructions and emergency procedures.

About

English Name 7-Chloroquinoline-3-carboxylic acid
Molecular Formula C10H6ClNO2
Molecular Weight 207.62 g/mol
SMILES C1=CC(=CC2=NC=C(C=C21)C(=O)O)Cl
InChIKey UFGQWTWQNIGAEB-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Chloroquinoline-3-carboxylic acid (CAS: 892874-49-6)?

7-Chloroquinoline-3-carboxylic acid is a white crystalline solid with a molecular weight of approxim...

Compound Q&A

How is 7-Chloroquinoline-3-carboxylic acid (CAS: 892874-49-6) typically synthesized?

7-Chloroquinoline-3-carboxylic acid is typically synthesized by the condensation of 7-chloroquinolin...

Compound Q&A

What industries use 7-Chloroquinoline-3-carboxylic acid (CAS: 892874-49-6)?

7-Chloroquinoline-3-carboxylic acid is used in various industries. It is a key intermediate in the s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...