Compound Q&A

What industries use 7-Chloroquinoline-3-carboxylic acid (CAS: 892874-49-6)?

Answer

7-Chloroquinoline-3-carboxylic acid
7-Chloroquinoline-3-carboxylic acid is used in various industries. It is a key intermediate in the synthesis of pharmaceuticals, particularly for the development of antimalarial drugs. Additionally, it is used in the production of dyes, pigments, and other organic compounds. Due to its chemical reactivity, it also finds applications in sensor technologies and as a precursor in semiconductor manufacturing.

About

English Name 7-Chloroquinoline-3-carboxylic acid
Molecular Formula C10H6ClNO2
Molecular Weight 207.62 g/mol
SMILES C1=CC(=CC2=NC=C(C=C21)C(=O)O)Cl
InChIKey UFGQWTWQNIGAEB-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Chloroquinoline-3-carboxylic acid (CAS: 892874-49-6)?

7-Chloroquinoline-3-carboxylic acid is a white crystalline solid with a molecular weight of approxim...

Compound Q&A

How is 7-Chloroquinoline-3-carboxylic acid (CAS: 892874-49-6) typically synthesized?

7-Chloroquinoline-3-carboxylic acid is typically synthesized by the condensation of 7-chloroquinolin...

Compound Q&A

What precautions should be taken when handling 7-Chloroquinoline-3-carboxylic acid (CAS: 892874-49-6)?

When handling 7-Chloroquinoline-3-carboxylic acid, appropriate personal protective equipment (PPE) s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...