Compound Q&A

What are the physical and chemical properties of 7-Chloroquinoline-3-carboxylic acid (CAS: 892874-49-6)?

Answer

7-Chloroquinoline-3-carboxylic acid
7-Chloroquinoline-3-carboxylic acid is a white crystalline solid with a molecular weight of approximately 213.01 g/mol. It is slightly soluble in water and more soluble in organic solvents like ethanol and acetone. Chemically, it is moderately reactive, showing basic properties due to the presence of the carboxylic acid group. It can react with bases to form salts and with certain reagents to undergo substitution reactions.

About

English Name 7-Chloroquinoline-3-carboxylic acid
Molecular Formula C10H6ClNO2
Molecular Weight 207.62 g/mol
SMILES C1=CC(=CC2=NC=C(C=C21)C(=O)O)Cl
InChIKey UFGQWTWQNIGAEB-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is 7-Chloroquinoline-3-carboxylic acid (CAS: 892874-49-6) typically synthesized?

7-Chloroquinoline-3-carboxylic acid is typically synthesized by the condensation of 7-chloroquinolin...

Compound Q&A

What industries use 7-Chloroquinoline-3-carboxylic acid (CAS: 892874-49-6)?

7-Chloroquinoline-3-carboxylic acid is used in various industries. It is a key intermediate in the s...

Compound Q&A

What precautions should be taken when handling 7-Chloroquinoline-3-carboxylic acid (CAS: 892874-49-6)?

When handling 7-Chloroquinoline-3-carboxylic acid, appropriate personal protective equipment (PPE) s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...