Compound Q&A

What industries use 2,6-Bis(2-methyl-2-propanyl)-4-nitrophenol (CAS: 728-40-5)?

Answer

2,6-Bis(2-methyl-2-propanyl)-4-nitrophenol
2,6-Bis(2-methyl-2-propanyl)-4-nitrophenol (CAS: 728-40-5) is used in the pharmaceutical industry for the synthesis of certain drugs, particularly those that require nitro functionalities. It is also utilized in the polymer industry for the production of specialty plastics and elastomers. Due to its reactivity, it finds applications in the development of sensors and electronic materials, including organic semiconductors and photodiodes.

About

CAS No 728-40-5
English Name 2,6-Bis(2-methyl-2-propanyl)-4-nitrophenol
Molecular Formula C14H21NO3
Molecular Weight 251.32 g/mol
SMILES CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)[N+](=O)[O-]
InChIKey FCGKUUOTWLWJHE-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,6-Bis(2-methyl-2-propanyl)-4-nitrophenol (CAS: 728-40-5)?

2,6-Bis(2-methyl-2-propanyl)-4-nitrophenol (CAS: 728-40-5) is a crystalline solid with a molecular w...

Compound Q&A

How is 2,6-Bis(2-methyl-2-propanyl)-4-nitrophenol (CAS: 728-40-5) typically synthesized?

2,6-Bis(2-methyl-2-propanyl)-4-nitrophenol is typically synthesized through the nitration of 2,6-bis...

Compound Q&A

What precautions should be taken when handling 2,6-Bis(2-methyl-2-propanyl)-4-nitrophenol (CAS: 728-40-5)?

Handling 2,6-Bis(2-methyl-2-propanyl)-4-nitrophenol (CAS: 728-40-5) requires strict safety measures....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...