Compound Q&A

What are the physical and chemical properties of 2,6-Bis(2-methyl-2-propanyl)-4-nitrophenol (CAS: 728-40-5)?

Answer

2,6-Bis(2-methyl-2-propanyl)-4-nitrophenol
2,6-Bis(2-methyl-2-propanyl)-4-nitrophenol (CAS: 728-40-5) is a crystalline solid with a molecular weight of approximately 274.18 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. This compound is known for its reactivity, particularly towards reduction and nitro group substitution reactions. It forms a deep red crystalline solid, and its melting point is around 75-77°C.

About

CAS No 728-40-5
English Name 2,6-Bis(2-methyl-2-propanyl)-4-nitrophenol
Molecular Formula C14H21NO3
Molecular Weight 251.32 g/mol
SMILES CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)[N+](=O)[O-]
InChIKey FCGKUUOTWLWJHE-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

How is 2,6-Bis(2-methyl-2-propanyl)-4-nitrophenol (CAS: 728-40-5) typically synthesized?

2,6-Bis(2-methyl-2-propanyl)-4-nitrophenol is typically synthesized through the nitration of 2,6-bis...

Compound Q&A

What industries use 2,6-Bis(2-methyl-2-propanyl)-4-nitrophenol (CAS: 728-40-5)?

2,6-Bis(2-methyl-2-propanyl)-4-nitrophenol (CAS: 728-40-5) is used in the pharmaceutical industry fo...

Compound Q&A

What precautions should be taken when handling 2,6-Bis(2-methyl-2-propanyl)-4-nitrophenol (CAS: 728-40-5)?

Handling 2,6-Bis(2-methyl-2-propanyl)-4-nitrophenol (CAS: 728-40-5) requires strict safety measures....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...