Compound Q&A

How is 2,6-Bis(2-methyl-2-propanyl)-4-nitrophenol (CAS: 728-40-5) typically synthesized?

Answer

2,6-Bis(2-methyl-2-propanyl)-4-nitrophenol
2,6-Bis(2-methyl-2-propanyl)-4-nitrophenol is typically synthesized through the nitration of 2,6-bis(2-methylpropyl)phenol. This involves treating the phenol with a mixture of nitric acid and sulfuric acid under controlled conditions. The reaction is carried out in a fume hood due to the generation of toxic gases. The yield is around 70-80%, and mild conditions are used to improve selectivity and reduce by-products.

About

CAS No 728-40-5
English Name 2,6-Bis(2-methyl-2-propanyl)-4-nitrophenol
Molecular Formula C14H21NO3
Molecular Weight 251.32 g/mol
SMILES CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)[N+](=O)[O-]
InChIKey FCGKUUOTWLWJHE-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,6-Bis(2-methyl-2-propanyl)-4-nitrophenol (CAS: 728-40-5)?

2,6-Bis(2-methyl-2-propanyl)-4-nitrophenol (CAS: 728-40-5) is a crystalline solid with a molecular w...

Compound Q&A

What industries use 2,6-Bis(2-methyl-2-propanyl)-4-nitrophenol (CAS: 728-40-5)?

2,6-Bis(2-methyl-2-propanyl)-4-nitrophenol (CAS: 728-40-5) is used in the pharmaceutical industry fo...

Compound Q&A

What precautions should be taken when handling 2,6-Bis(2-methyl-2-propanyl)-4-nitrophenol (CAS: 728-40-5)?

Handling 2,6-Bis(2-methyl-2-propanyl)-4-nitrophenol (CAS: 728-40-5) requires strict safety measures....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...