Compound Q&A

What precautions should be taken when handling (2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(2-oxo-2,3-dihydro-1H-indol-3-yl)propanoic acid (CAS: 1290040-14-0)?

Answer

(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(2-oxo-2,3-dihydro-1H-indol-3-yl)propanoic acid
When handling this compound, it is essential to wear appropriate personal protective equipment (PPE), including gloves, safety goggles, and lab coat. Ensure that the work is conducted in a fume hood to minimize inhalation risks. Spills should be cleaned up using appropriate absorbent materials, and the area should be well-ventilated. Always refer to the Material Safety Data Sheet (MSDS/SDS) for detailed information on storage, emergency procedures, and disposal methods.

About

English Name (2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(2-oxo-2,3-dihydro-1H-indol-3-yl)propanoic acid
Molecular Formula C26H22N2O5
Molecular Weight 442.46 g/mol
SMILES O=C(N[C@H](C(=O)O)CC1C(=O)Nc2c1cccc2)OCC1c2ccccc2c2c1cccc2
InChIKey JLKDRJNEVVDHFA-AKRCKQFNSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(2-oxo-2,3-dihydro-1H-indol-3-yl)propanoic acid (CAS: 1290040-14-0)?

The compound (2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(2-oxo-2,3-dihydro-1H-indol-3-yl)p...

Compound Q&A

How is (2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(2-oxo-2,3-dihydro-1H-indol-3-yl)propanoic acid (CAS: 1290040-14-0) typically synthesized?

The compound is typically synthesized via a multi-step synthesis involving the formation of an amide...

Compound Q&A

What industries use (2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(2-oxo-2,3-dihydro-1H-indol-3-yl)propanoic acid (CAS: 1290040-14-0)?

This compound finds applications in the pharmaceutical industry, specifically in the development of ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...