Compound Q&A

What are the physical and chemical properties of (2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(2-oxo-2,3-dihydro-1H-indol-3-yl)propanoic acid (CAS: 1290040-14-0)?

Answer

(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(2-oxo-2,3-dihydro-1H-indol-3-yl)propanoic acid
The compound (2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(2-oxo-2,3-dihydro-1H-indol-3-yl)propanoic acid is a crystalline solid with a molecular weight of approximately 479.5 g/mol. Its solubility in water is low, and it is moderately soluble in organic solvents like DMSO. The compound is reactive towards nucleophilic attack, particularly at the amino and carboxylic acid functionalities. It is stable under normal temperature and pressure conditions but should be stored in a cool, dry place to maintain its structural integrity.

About

English Name (2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(2-oxo-2,3-dihydro-1H-indol-3-yl)propanoic acid
Molecular Formula C26H22N2O5
Molecular Weight 442.46 g/mol
SMILES O=C(N[C@H](C(=O)O)CC1C(=O)Nc2c1cccc2)OCC1c2ccccc2c2c1cccc2
InChIKey JLKDRJNEVVDHFA-AKRCKQFNSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

How is (2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(2-oxo-2,3-dihydro-1H-indol-3-yl)propanoic acid (CAS: 1290040-14-0) typically synthesized?

The compound is typically synthesized via a multi-step synthesis involving the formation of an amide...

Compound Q&A

What industries use (2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(2-oxo-2,3-dihydro-1H-indol-3-yl)propanoic acid (CAS: 1290040-14-0)?

This compound finds applications in the pharmaceutical industry, specifically in the development of ...

Compound Q&A

What precautions should be taken when handling (2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(2-oxo-2,3-dihydro-1H-indol-3-yl)propanoic acid (CAS: 1290040-14-0)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...