Compound Q&A

What precautions should be taken when handling 3-(2-Bromophenyl)acrylic acid (CAS: 7499-56-1)?

Answer

3-(2-Bromophenyl)acrylic acid
When handling 3-(2-Bromophenyl)acrylic acid (CAS: 7499-56-1), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and lab coats. This compound should be used in a fume hood to minimize inhalation risks. In case of a spill, neutralize the acid with a base and carefully clean up the area. Always refer to the Safety Data Sheet (SDS) for detailed safety information and emergency procedures.

About

CAS No 7499-56-1
English Name 3-(2-Bromophenyl)acrylic acid
Molecular Formula C9H7BrO2
Molecular Weight 227.06 g/mol
SMILES C1=CC=C(C(=C1)C=CC(=O)O)Br
InChIKey OMHDOOAFLCMRFX-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(2-Bromophenyl)acrylic acid (CAS: 7499-56-1)?

3-(2-Bromophenyl)acrylic acid (CAS: 7499-56-1) is a crystalline solid with a molecular weight of app...

Compound Q&A

How is 3-(2-Bromophenyl)acrylic acid (CAS: 7499-56-1) typically synthesized?

3-(2-Bromophenyl)acrylic acid is typically synthesized through a bromination reaction of 2-hydroxybe...

Compound Q&A

What industries use 3-(2-Bromophenyl)acrylic acid (CAS: 7499-56-1)?

3-(2-Bromophenyl)acrylic acid (CAS: 7499-56-1) is used in various industries including pharmaceutica...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...