Compound Q&A

What are the physical and chemical properties of 3-(2-Bromophenyl)acrylic acid (CAS: 7499-56-1)?

Answer

3-(2-Bromophenyl)acrylic acid
3-(2-Bromophenyl)acrylic acid (CAS: 7499-56-1) is a crystalline solid with a molecular weight of approximately 245.01 g/mol. It has a low solubility in water (0.1 g/100 mL at 20°C) and is soluble in organic solvents like ethanol and acetone. This compound exhibits moderate reactivity, particularly towards nucleophiles and reducing agents. It is stable under normal conditions but should be stored in a cool, dry place, away from direct sunlight.

About

CAS No 7499-56-1
English Name 3-(2-Bromophenyl)acrylic acid
Molecular Formula C9H7BrO2
Molecular Weight 227.06 g/mol
SMILES C1=CC=C(C(=C1)C=CC(=O)O)Br
InChIKey OMHDOOAFLCMRFX-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

How is 3-(2-Bromophenyl)acrylic acid (CAS: 7499-56-1) typically synthesized?

3-(2-Bromophenyl)acrylic acid is typically synthesized through a bromination reaction of 2-hydroxybe...

Compound Q&A

What industries use 3-(2-Bromophenyl)acrylic acid (CAS: 7499-56-1)?

3-(2-Bromophenyl)acrylic acid (CAS: 7499-56-1) is used in various industries including pharmaceutica...

Compound Q&A

What precautions should be taken when handling 3-(2-Bromophenyl)acrylic acid (CAS: 7499-56-1)?

When handling 3-(2-Bromophenyl)acrylic acid (CAS: 7499-56-1), it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...