Compound Q&A

What industries use 3-(2-Bromophenyl)acrylic acid (CAS: 7499-56-1)?

Answer

3-(2-Bromophenyl)acrylic acid
3-(2-Bromophenyl)acrylic acid (CAS: 7499-56-1) is used in various industries including pharmaceuticals, where it serves as a precursor for drug synthesis, and in the polymer industry for the production of functional coatings and adhesives. It is also employed in the development of sensors and semiconductors due to its unique chemical properties.

About

CAS No 7499-56-1
English Name 3-(2-Bromophenyl)acrylic acid
Molecular Formula C9H7BrO2
Molecular Weight 227.06 g/mol
SMILES C1=CC=C(C(=C1)C=CC(=O)O)Br
InChIKey OMHDOOAFLCMRFX-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(2-Bromophenyl)acrylic acid (CAS: 7499-56-1)?

3-(2-Bromophenyl)acrylic acid (CAS: 7499-56-1) is a crystalline solid with a molecular weight of app...

Compound Q&A

How is 3-(2-Bromophenyl)acrylic acid (CAS: 7499-56-1) typically synthesized?

3-(2-Bromophenyl)acrylic acid is typically synthesized through a bromination reaction of 2-hydroxybe...

Compound Q&A

What precautions should be taken when handling 3-(2-Bromophenyl)acrylic acid (CAS: 7499-56-1)?

When handling 3-(2-Bromophenyl)acrylic acid (CAS: 7499-56-1), it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...