Compound Q&A

What precautions should be taken when handling bis(N,N-dimethylguanidine), sulfuric acid (CAS: 598-65-2)?

Answer

bis(N,N-dimethylguanidine), sulfuric acid
When handling bis(N,N-dimethylguanidine), sulfuric acid (CAS: 598-65-2), it is essential to wear appropriate personal protective equipment (PPE), including gloves, safety goggles, and a laboratory coat. The compound should be stored in a well-ventilated area and handled in a fume hood to minimize exposure. Proper spill cleanup procedures should be followed, and the Material Safety Data Sheet (MSDS) should be readily available for reference. Handling should be done with care to avoid contact with skin and eyes, as the compound can cause irritation.

About

CAS No 598-65-2
English Name bis(N,N-dimethylguanidine), sulfuric acid
Molecular Formula C6H20N6O4S
Molecular Weight 272.33 g/mol
SMILES CN(C)C(=N)N.CN(C)C(=N)N.OS(=O)(=O)O
InChIKey QSCHFHVDZCPIKX-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of bis(N,N-dimethylguanidine), sulfuric acid (CAS: 598-65-2)?

Bis(N,N-dimethylguanidine), sulfuric acid (CAS: 598-65-2) is a crystalline compound with a molecular...

Compound Q&A

How is bis(N,N-dimethylguanidine), sulfuric acid (CAS: 598-65-2) typically synthesized?

Bis(N,N-dimethylguanidine), sulfuric acid (CAS: 598-65-2) is typically synthesized by the reaction o...

Compound Q&A

What industries use bis(N,N-dimethylguanidine), sulfuric acid (CAS: 598-65-2)?

Bis(N,N-dimethylguanidine), sulfuric acid (CAS: 598-65-2) is used in various industries, including p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...