Compound Q&A

What are the physical and chemical properties of bis(N,N-dimethylguanidine), sulfuric acid (CAS: 598-65-2)?

Answer

bis(N,N-dimethylguanidine), sulfuric acid
Bis(N,N-dimethylguanidine), sulfuric acid (CAS: 598-65-2) is a crystalline compound with a molecular weight of approximately 272.11 g/mol. It has a high solubility in water and a low solubility in organic solvents. The compound exhibits basic properties due to the guanidine groups. It is reactive, especially in acidic conditions, and can undergo protonation reactions easily.

About

CAS No 598-65-2
English Name bis(N,N-dimethylguanidine), sulfuric acid
Molecular Formula C6H20N6O4S
Molecular Weight 272.33 g/mol
SMILES CN(C)C(=N)N.CN(C)C(=N)N.OS(=O)(=O)O
InChIKey QSCHFHVDZCPIKX-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

How is bis(N,N-dimethylguanidine), sulfuric acid (CAS: 598-65-2) typically synthesized?

Bis(N,N-dimethylguanidine), sulfuric acid (CAS: 598-65-2) is typically synthesized by the reaction o...

Compound Q&A

What industries use bis(N,N-dimethylguanidine), sulfuric acid (CAS: 598-65-2)?

Bis(N,N-dimethylguanidine), sulfuric acid (CAS: 598-65-2) is used in various industries, including p...

Compound Q&A

What precautions should be taken when handling bis(N,N-dimethylguanidine), sulfuric acid (CAS: 598-65-2)?

When handling bis(N,N-dimethylguanidine), sulfuric acid (CAS: 598-65-2), it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...