Compound Q&A

What industries use bis(N,N-dimethylguanidine), sulfuric acid (CAS: 598-65-2)?

Answer

bis(N,N-dimethylguanidine), sulfuric acid
Bis(N,N-dimethylguanidine), sulfuric acid (CAS: 598-65-2) is used in various industries, including pharmaceuticals for the synthesis of drugs, polymers for the modification of materials, and sensors for the detection of gases and chemicals. It also finds applications in semiconductors for etching processes and as a catalyst in certain organic reactions.

About

CAS No 598-65-2
English Name bis(N,N-dimethylguanidine), sulfuric acid
Molecular Formula C6H20N6O4S
Molecular Weight 272.33 g/mol
SMILES CN(C)C(=N)N.CN(C)C(=N)N.OS(=O)(=O)O
InChIKey QSCHFHVDZCPIKX-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of bis(N,N-dimethylguanidine), sulfuric acid (CAS: 598-65-2)?

Bis(N,N-dimethylguanidine), sulfuric acid (CAS: 598-65-2) is a crystalline compound with a molecular...

Compound Q&A

How is bis(N,N-dimethylguanidine), sulfuric acid (CAS: 598-65-2) typically synthesized?

Bis(N,N-dimethylguanidine), sulfuric acid (CAS: 598-65-2) is typically synthesized by the reaction o...

Compound Q&A

What precautions should be taken when handling bis(N,N-dimethylguanidine), sulfuric acid (CAS: 598-65-2)?

When handling bis(N,N-dimethylguanidine), sulfuric acid (CAS: 598-65-2), it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...