Compound Q&A

How is bis(N,N-dimethylguanidine), sulfuric acid (CAS: 598-65-2) typically synthesized?

Answer

bis(N,N-dimethylguanidine), sulfuric acid
Bis(N,N-dimethylguanidine), sulfuric acid (CAS: 598-65-2) is typically synthesized by the reaction of dimethylguanidine with sulfuric acid. The process involves the stepwise protonation of dimethylguanidine to form the corresponding sulfoxide and then further protonation to form the bisguanidine sulfate. The reaction is carried out under mild conditions with high yield and good selectivity.

About

CAS No 598-65-2
English Name bis(N,N-dimethylguanidine), sulfuric acid
Molecular Formula C6H20N6O4S
Molecular Weight 272.33 g/mol
SMILES CN(C)C(=N)N.CN(C)C(=N)N.OS(=O)(=O)O
InChIKey QSCHFHVDZCPIKX-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of bis(N,N-dimethylguanidine), sulfuric acid (CAS: 598-65-2)?

Bis(N,N-dimethylguanidine), sulfuric acid (CAS: 598-65-2) is a crystalline compound with a molecular...

Compound Q&A

What industries use bis(N,N-dimethylguanidine), sulfuric acid (CAS: 598-65-2)?

Bis(N,N-dimethylguanidine), sulfuric acid (CAS: 598-65-2) is used in various industries, including p...

Compound Q&A

What precautions should be taken when handling bis(N,N-dimethylguanidine), sulfuric acid (CAS: 598-65-2)?

When handling bis(N,N-dimethylguanidine), sulfuric acid (CAS: 598-65-2), it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...