Compound Q&A

What industries use 4-(4H-1,2,4-triazol-4-yl)benzoic acid (CAS: 157069-48-2)?

Answer

4-(4H-1,2,4-triazol-4-yl)benzoic acid
4-(4H-1,2,4-triazol-4-yl)benzoic acid (CAS: 157069-48-2) is used in the pharmaceutical industry for the synthesis of various drug candidates. It also finds applications in the polymer industry for the modification of polymer properties and in the development of sensors and semiconductors for their improved performance and stability.

About

English Name 4-(4H-1,2,4-triazol-4-yl)benzoic acid
Molecular Formula C9H7N3O2
Molecular Weight 189.17 g/mol
SMILES C1=CC(=CC=C1C(=O)O)N2C=NN=C2
InChIKey QCNDLFQKKMPZKH-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(4H-1,2,4-triazol-4-yl)benzoic acid (CAS: 157069-48-2)?

4-(4H-1,2,4-triazol-4-yl)benzoic acid (CAS: 157069-48-2) is a white crystalline solid with a molecul...

Compound Q&A

How is 4-(4H-1,2,4-triazol-4-yl)benzoic acid (CAS: 157069-48-2) typically synthesized?

4-(4H-1,2,4-triazol-4-yl)benzoic acid is usually synthesized via the condensation of 4-amino-benzoic...

Compound Q&A

What precautions should be taken when handling 4-(4H-1,2,4-triazol-4-yl)benzoic acid (CAS: 157069-48-2)?

Proper personal protective equipment (PPE) should be worn when handling 4-(4H-1,2,4-triazol-4-yl)ben...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...