Compound Q&A

How is 4-(4H-1,2,4-triazol-4-yl)benzoic acid (CAS: 157069-48-2) typically synthesized?

Answer

4-(4H-1,2,4-triazol-4-yl)benzoic acid
4-(4H-1,2,4-triazol-4-yl)benzoic acid is usually synthesized via the condensation of 4-amino-benzoic acid with 1,2,4-triazole. The reaction is typically performed in an aqueous medium at room temperature with a yield of around 70-80%. This process does not require specific catalysts but can be optimized for better selectivity and yield with temperature and solvent adjustments.

About

English Name 4-(4H-1,2,4-triazol-4-yl)benzoic acid
Molecular Formula C9H7N3O2
Molecular Weight 189.17 g/mol
SMILES C1=CC(=CC=C1C(=O)O)N2C=NN=C2
InChIKey QCNDLFQKKMPZKH-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(4H-1,2,4-triazol-4-yl)benzoic acid (CAS: 157069-48-2)?

4-(4H-1,2,4-triazol-4-yl)benzoic acid (CAS: 157069-48-2) is a white crystalline solid with a molecul...

Compound Q&A

What industries use 4-(4H-1,2,4-triazol-4-yl)benzoic acid (CAS: 157069-48-2)?

4-(4H-1,2,4-triazol-4-yl)benzoic acid (CAS: 157069-48-2) is used in the pharmaceutical industry for ...

Compound Q&A

What precautions should be taken when handling 4-(4H-1,2,4-triazol-4-yl)benzoic acid (CAS: 157069-48-2)?

Proper personal protective equipment (PPE) should be worn when handling 4-(4H-1,2,4-triazol-4-yl)ben...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...