Compound Q&A

What precautions should be taken when handling 4-(2,4-Difluorophenyl)-4-oxobutanoic acid (CAS: 110931-77-6)?

Answer

4-(2,4-Difluorophenyl)-4-oxobutanoic acid
When handling 4-(2,4-Difluorophenyl)-4-oxobutanoic acid, it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. Work should be conducted in a well-ventilated area or fume hood. Spills should be cleaned up immediately with appropriate absorbents. Always consult the Safety Data Sheet (SDS) for specific handling and disposal instructions. Storage should be at room temperature in a dry, well-ventilated area away from heat sources and incompatible materials.

About

English Name 4-(2,4-Difluorophenyl)-4-oxobutanoic acid
Molecular Formula C10H8F2O3
Molecular Weight 214.17 g/mol
SMILES C1=CC(=C(C=C1F)F)C(=O)CCC(=O)O
InChIKey OKYUHFSCTFNDFB-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(2,4-Difluorophenyl)-4-oxobutanoic acid (CAS: 110931-77-6)?

4-(2,4-Difluorophenyl)-4-oxobutanoic acid is a white crystalline solid with a molecular weight of ap...

Compound Q&A

How is 4-(2,4-Difluorophenyl)-4-oxobutanoic acid (CAS: 110931-77-6) typically synthesized?

4-(2,4-Difluorophenyl)-4-oxobutanoic acid is commonly synthesized via a multi-step process involving...

Compound Q&A

What industries use 4-(2,4-Difluorophenyl)-4-oxobutanoic acid (CAS: 110931-77-6)?

4-(2,4-Difluorophenyl)-4-oxobutanoic acid is primarily used in the pharmaceutical industry for the s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...