Compound Q&A

What are the physical and chemical properties of 4-(2,4-Difluorophenyl)-4-oxobutanoic acid (CAS: 110931-77-6)?

Answer

4-(2,4-Difluorophenyl)-4-oxobutanoic acid
4-(2,4-Difluorophenyl)-4-oxobutanoic acid is a white crystalline solid with a molecular weight of approximately 215.07 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol and acetonitrile. The compound is relatively stable under normal conditions but can react with strong bases and acids. It is typically used in pharmaceutical applications and has a melting point of around 165-167°C.

About

English Name 4-(2,4-Difluorophenyl)-4-oxobutanoic acid
Molecular Formula C10H8F2O3
Molecular Weight 214.17 g/mol
SMILES C1=CC(=C(C=C1F)F)C(=O)CCC(=O)O
InChIKey OKYUHFSCTFNDFB-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is 4-(2,4-Difluorophenyl)-4-oxobutanoic acid (CAS: 110931-77-6) typically synthesized?

4-(2,4-Difluorophenyl)-4-oxobutanoic acid is commonly synthesized via a multi-step process involving...

Compound Q&A

What industries use 4-(2,4-Difluorophenyl)-4-oxobutanoic acid (CAS: 110931-77-6)?

4-(2,4-Difluorophenyl)-4-oxobutanoic acid is primarily used in the pharmaceutical industry for the s...

Compound Q&A

What precautions should be taken when handling 4-(2,4-Difluorophenyl)-4-oxobutanoic acid (CAS: 110931-77-6)?

When handling 4-(2,4-Difluorophenyl)-4-oxobutanoic acid, it is crucial to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...