Compound Q&A

What industries use 4-(2,4-Difluorophenyl)-4-oxobutanoic acid (CAS: 110931-77-6)?

Answer

4-(2,4-Difluorophenyl)-4-oxobutanoic acid
4-(2,4-Difluorophenyl)-4-oxobutanoic acid is primarily used in the pharmaceutical industry for the synthesis of various medicinals. It is also utilized in the polymer industry to enhance material properties and in the sensor industry for its reactivity with specific analytes. Additionally, it finds application in semiconductor technology for its potential use in etching solutions.

About

English Name 4-(2,4-Difluorophenyl)-4-oxobutanoic acid
Molecular Formula C10H8F2O3
Molecular Weight 214.17 g/mol
SMILES C1=CC(=C(C=C1F)F)C(=O)CCC(=O)O
InChIKey OKYUHFSCTFNDFB-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(2,4-Difluorophenyl)-4-oxobutanoic acid (CAS: 110931-77-6)?

4-(2,4-Difluorophenyl)-4-oxobutanoic acid is a white crystalline solid with a molecular weight of ap...

Compound Q&A

How is 4-(2,4-Difluorophenyl)-4-oxobutanoic acid (CAS: 110931-77-6) typically synthesized?

4-(2,4-Difluorophenyl)-4-oxobutanoic acid is commonly synthesized via a multi-step process involving...

Compound Q&A

What precautions should be taken when handling 4-(2,4-Difluorophenyl)-4-oxobutanoic acid (CAS: 110931-77-6)?

When handling 4-(2,4-Difluorophenyl)-4-oxobutanoic acid, it is crucial to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...