Compound Q&A

What precautions should be taken when handling 2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid (CAS: 61338-13-4)?

Answer

2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid
When handling 2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid (CAS: 61338-13-4), appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn. The compound should be stored in a cool, dry place away from direct sunlight and heat sources. In case of a spill, it should be neutralized with an appropriate base before disposal. Always consult the Safety Data Sheet (SDS) for specific handling and disposal information.

About

CAS No 61338-13-4
English Name 2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid
Molecular Formula C17H19N3O2
Molecular Weight 297.36 g/mol
SMILES CN1CCN(C(C1)C1=CC=CC=C1)C1=C(C=CC=N1)C(O)=O
InChIKey HCVDLMUVEGPGGH-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid (CAS: 61338-13-4)?

2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid (CAS: 61338-13-4) is a crystalline compound with a...

Compound Q&A

How is 2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid (CAS: 61338-13-4) typically synthesized?

2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid (CAS: 61338-13-4) can be synthesized through ester...

Compound Q&A

What industries use 2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid (CAS: 61338-13-4)?

2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid (CAS: 61338-13-4) is primarily used in the pharmac...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...