Compound Q&A

How is 2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid (CAS: 61338-13-4) typically synthesized?

Answer

2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid
2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid (CAS: 61338-13-4) can be synthesized through esterification of 2-(4-methyl-2-phenyl-1-piperazinyl)isonicotinic acid with acetic anhydride. The reaction is typically conducted in the presence of a catalytic amount of an acid like sulfuric acid. The yield is usually around 85-90%, with the product being isolated by recrystallization from ethanol.

About

CAS No 61338-13-4
English Name 2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid
Molecular Formula C17H19N3O2
Molecular Weight 297.36 g/mol
SMILES CN1CCN(C(C1)C1=CC=CC=C1)C1=C(C=CC=N1)C(O)=O
InChIKey HCVDLMUVEGPGGH-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid (CAS: 61338-13-4)?

2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid (CAS: 61338-13-4) is a crystalline compound with a...

Compound Q&A

What industries use 2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid (CAS: 61338-13-4)?

2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid (CAS: 61338-13-4) is primarily used in the pharmac...

Compound Q&A

What precautions should be taken when handling 2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid (CAS: 61338-13-4)?

When handling 2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid (CAS: 61338-13-4), appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...