Compound Q&A

What are the physical and chemical properties of 2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid (CAS: 61338-13-4)?

Answer

2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid
2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid (CAS: 61338-13-4) is a crystalline compound with a molecular weight of approximately 315.36 g/mol. It has a solubility of about 2.5 mg/mL in water and is slightly soluble in ethanol. The compound is relatively stable under normal conditions, but it can undergo hydrolysis under basic conditions. It shows moderate reactivity with primary amines and nucleophiles.

About

CAS No 61338-13-4
English Name 2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid
Molecular Formula C17H19N3O2
Molecular Weight 297.36 g/mol
SMILES CN1CCN(C(C1)C1=CC=CC=C1)C1=C(C=CC=N1)C(O)=O
InChIKey HCVDLMUVEGPGGH-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is 2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid (CAS: 61338-13-4) typically synthesized?

2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid (CAS: 61338-13-4) can be synthesized through ester...

Compound Q&A

What industries use 2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid (CAS: 61338-13-4)?

2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid (CAS: 61338-13-4) is primarily used in the pharmac...

Compound Q&A

What precautions should be taken when handling 2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid (CAS: 61338-13-4)?

When handling 2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid (CAS: 61338-13-4), appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...