Compound Q&A

What industries use 2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid (CAS: 61338-13-4)?

Answer

2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid
2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid (CAS: 61338-13-4) is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various drugs, particularly those involving piperazine derivatives. It is also utilized in the production of certain polymers, sensors, and semiconductors for their unique chemical properties.

About

CAS No 61338-13-4
English Name 2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid
Molecular Formula C17H19N3O2
Molecular Weight 297.36 g/mol
SMILES CN1CCN(C(C1)C1=CC=CC=C1)C1=C(C=CC=N1)C(O)=O
InChIKey HCVDLMUVEGPGGH-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid (CAS: 61338-13-4)?

2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid (CAS: 61338-13-4) is a crystalline compound with a...

Compound Q&A

How is 2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid (CAS: 61338-13-4) typically synthesized?

2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid (CAS: 61338-13-4) can be synthesized through ester...

Compound Q&A

What precautions should be taken when handling 2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid (CAS: 61338-13-4)?

When handling 2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid (CAS: 61338-13-4), appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...